C22H25N3O3 — CID 17238888
4-[4-(diethylamino)phenyl]-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol (PubChem CID 17238888) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol.
| Compound Name | 4-[4-(diethylamino)phenyl]-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol |
|---|---|
| PubChem CID | 17238888 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol |
| SMILES | CCN(CC)c1ccc(C2Nc3c(O)cc([N+](=O)[O-])cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-3-24(4-2)15-10-8-14(9-11-15)21-18-7-5-6-17(18)19-12-16(25(27)28)13-20(26)22(19)23-21/h5-6,8-13,17-18,21,23,26H,3-4,7H2,1-2H3 |
| InChIKey | SZJJVGHSCYJCOJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|