C24H30N2O2 — CID 17238886
4-(6,9-dimethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-diethylaniline (PubChem CID 17238886) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-(6,9-dimethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-diethylaniline.
| Compound Name | 4-(6,9-dimethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 17238886 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-(6,9-dimethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C2Nc3c(OC)ccc(OC)c3C3C=CCC32)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-5-26(6-2)17-12-10-16(11-13-17)23-19-9-7-8-18(19)22-20(27-3)14-15-21(28-4)24(22)25-23/h7-8,10-15,18-19,23,25H,5-6,9H2,1-4H3 |
| InChIKey | QAVZMCGIMUXYCY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|