C30H32N2O — CID 17237949
N-(1-phenylethyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17237949) has the molecular formula C30H32N2O and a molecular weight of 436.60 g/mol. Its IUPAC name is N-(1-phenylethyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-(1-phenylethyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17237949 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-(1-phenylethyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | Cc1cc(C)c(C2Nc3c(C(=O)NC(C)c4ccccc4)cccc3C3C=CCC32)c(C)c1 |
| InChI | InChI=1S/C30H32N2O/c1-18-16-19(2)27(20(3)17-18)29-25-14-8-12-23(25)24-13-9-15-26(28(24)32-29)30(33)31-21(4)22-10-6-5-7-11-22/h5-13,15-17,21,23,25,29,32H,14H2,1-4H3,(H,31,33) |
| InChIKey | IZXCOJDZHLKWHZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|