C25H24N2OS — CID 17243532
N-(1-phenylethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17243532) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is N-(1-phenylethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-(1-phenylethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17243532 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(1-phenylethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CC(NC(=O)c1cccc2c1NC(c1cccs1)C1CC=CC21)c1ccccc1 |
| InChI | InChI=1S/C25H24N2OS/c1-16(17-8-3-2-4-9-17)26-25(28)21-13-6-11-19-18-10-5-12-20(18)24(27-23(19)21)22-14-7-15-29-22/h2-11,13-16,18,20,24,27H,12H2,1H3,(H,26,28) |
| InChIKey | FOXUOLUOBSOVLU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|