C22H23N3O3 — CID 17240350
4-(3-nitrophenyl)-N-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17240350) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-N-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-(3-nitrophenyl)-N-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17240350 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(3-nitrophenyl)-N-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CC(C)NC(=O)c1cccc2c1NC(c1cccc([N+](=O)[O-])c1)C1CC=CC21 |
| InChI | InChI=1S/C22H23N3O3/c1-13(2)23-22(26)19-11-5-10-18-16-8-4-9-17(16)20(24-21(18)19)14-6-3-7-15(12-14)25(27)28/h3-8,10-13,16-17,20,24H,9H2,1-2H3,(H,23,26) |
| InChIKey | KLRHMYNWIPAPEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|