About hex-4-en-3-one
hex-4-en-3-one (PubChem CID 17244) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is hex-4-en-3-one.
Molecular Properties
| Compound Name | hex-4-en-3-one |
| PubChem CID | 17244 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | hex-4-en-3-one |
| SMILES | CC=CC(=O)CC |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h3,5H,4H2,1-2H3 |
| InChIKey | FEWIGMWODIRUJM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-4-en-3-one?
The IUPAC name of hex-4-en-3-one (CID 17244) is hex-4-en-3-one.
What is the SMILES notation for hex-4-en-3-one?
The canonical SMILES for hex-4-en-3-one is CC=CC(=O)CC.
What is the InChIKey of hex-4-en-3-one?
The InChIKey is FEWIGMWODIRUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c1-3-5-6(7)4-2/h3,5H,4H2,1-2H3.
What are the key properties of hex-4-en-3-one?
hex-4-en-3-one has a molecular weight of 98.14 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-4-en-3-one is sourced from PubChem (CID 17244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).