C19H22FN3O2 — CID 17246092
N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17246092) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17246092 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H22FN3O2/c1-24-19-5-3-2-4-16(19)14-22-21-13-15-6-7-18(17(20)12-15)23-8-10-25-11-9-23/h2-7,12-13,22H,8-11,14H2,1H3/b21-13+ |
| InChIKey | CWYGGNQILDFXDB-FYJGNVAPSA-N |
| XLogP | 2.79 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|