C20H19BrN2O4S2 — CID 17246864
4-bromo-N-methyl-N-[2-(morpholine-4-carbonyl)-1-benzothiophen-5-yl]benzenesulfonamide (PubChem CID 17246864) has the molecular formula C20H19BrN2O4S2 and a molecular weight of 495.42 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-[2-(morpholine-4-carbonyl)-1-benzothiophen-5-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-methyl-N-[2-(morpholine-4-carbonyl)-1-benzothiophen-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 17246864 |
| Molecular Formula | C20H19BrN2O4S2 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 4-bromo-N-methyl-N-[2-(morpholine-4-carbonyl)-1-benzothiophen-5-yl]benzenesulfonamide |
| SMILES | CN(c1ccc2sc(C(=O)N3CCOCC3)cc2c1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrN2O4S2/c1-22(29(25,26)17-5-2-15(21)3-6-17)16-4-7-18-14(12-16)13-19(28-18)20(24)23-8-10-27-11-9-23/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | DWZYKNQDFUNSQS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |