C21H18Cl2N2O4S — CID 17247035
2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 17247035) has the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.36 g/mol. Its IUPAC name is 2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17247035 |
| Molecular Formula | C21H18Cl2N2O4S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | CN(c1ccc(OCC(=O)Nc2cccc(Cl)c2Cl)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18Cl2N2O4S/c1-25(30(27,28)17-6-3-2-4-7-17)15-10-12-16(13-11-15)29-14-20(26)24-19-9-5-8-18(22)21(19)23/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | ABLCBRWQTAFFHG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |