C28H26N2O4S2 — CID 17247177
2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 17247177) has the molecular formula C28H26N2O4S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 17247177 |
| Molecular Formula | C28H26N2O4S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | CCN(c1ccc(OCC(=O)Nc2ccccc2Sc2ccccc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O4S2/c1-2-30(36(32,33)25-13-7-4-8-14-25)22-17-19-23(20-18-22)34-21-28(31)29-26-15-9-10-16-27(26)35-24-11-5-3-6-12-24/h3-20H,2,21H2,1H3,(H,29,31) |
| InChIKey | FPCGLTBNIZHBRL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |