C24H21F3N2O6S — CID 2388120
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]acetate (PubChem CID 2388120) has the molecular formula C24H21F3N2O6S and a molecular weight of 522.50 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]acetate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 2388120 |
| Molecular Formula | C24H21F3N2O6S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[benzenesulfonyl(ethyl)amino]phenoxy]acetate |
| SMILES | CCN(c1ccc(OCC(=O)OCC(=O)Nc2ccc(F)c(F)c2F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21F3N2O6S/c1-2-29(36(32,33)18-6-4-3-5-7-18)16-8-10-17(11-9-16)34-15-22(31)35-14-21(30)28-20-13-12-19(25)23(26)24(20)27/h3-13H,2,14-15H2,1H3,(H,28,30) |
| InChIKey | OMCLFWDUTVJJEY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|