C25H22F3N3O7S — CID 23877777
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate (PubChem CID 23877777) has the molecular formula C25H22F3N3O7S and a molecular weight of 565.53 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 23877777 |
| Molecular Formula | C25H22F3N3O7S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)c2ccc(OCC(=O)OCC(=O)Nc3ccc(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C25H22F3N3O7S/c1-15(32)29-16-3-9-19(10-4-16)39(35,36)31(2)17-5-7-18(8-6-17)37-14-23(34)38-13-22(33)30-21-12-11-20(26)24(27)25(21)28/h3-12H,13-14H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | CNVONNDZBLQFNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|