C25H23BrN4O9S — CID 23851361
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate (PubChem CID 23851361) has the molecular formula C25H23BrN4O9S and a molecular weight of 635.45 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 23851361 |
| Molecular Formula | C25H23BrN4O9S |
| Molecular Weight | 635.45 g/mol |
| Exact Mass | 634.04 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)c2ccc(OCC(=O)OCC(=O)Nc3ccc([N+](=O)[O-])cc3Br)cc2)cc1 |
| InChI | InChI=1S/C25H23BrN4O9S/c1-16(31)27-17-3-10-21(11-4-17)40(36,37)29(2)18-5-8-20(9-6-18)38-15-25(33)39-14-24(32)28-23-12-7-19(30(34)35)13-22(23)26/h3-13H,14-15H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | XRFINQGKEUZKAP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|