C17H16BrN3O7S — CID 46788858
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 46788858) has the molecular formula C17H16BrN3O7S and a molecular weight of 486.30 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 46788858 |
| Molecular Formula | C17H16BrN3O7S |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 484.99 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)cc1 |
| InChI | InChI=1S/C17H16BrN3O7S/c1-11-2-5-13(6-3-11)29(26,27)19-9-17(23)28-10-16(22)20-15-7-4-12(21(24)25)8-14(15)18/h2-8,19H,9-10H2,1H3,(H,20,22) |
| InChIKey | SKVKMKBTDBPZQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|