C17H14BrCl2N3O7S — CID 4831028
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate (PubChem CID 4831028) has the molecular formula C17H14BrCl2N3O7S and a molecular weight of 555.19 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 4831028 |
| Molecular Formula | C17H14BrCl2N3O7S |
| Molecular Weight | 555.19 g/mol |
| Exact Mass | 552.91 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
| SMILES | O=C(COC(=O)CCNS(=O)(=O)c1c(Cl)cccc1Cl)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C17H14BrCl2N3O7S/c18-11-8-10(23(26)27)4-5-14(11)22-15(24)9-30-16(25)6-7-21-31(28,29)17-12(19)2-1-3-13(17)20/h1-5,8,21H,6-7,9H2,(H,22,24) |
| InChIKey | QJNWTFSRUCIDNQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|