C18H16BrN3O7S — CID 29200606
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 29200606) has the molecular formula C18H16BrN3O7S and a molecular weight of 498.31 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 29200606 |
| Molecular Formula | C18H16BrN3O7S |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)/C=C/c1ccccc1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H16BrN3O7S/c19-15-10-14(22(25)26)6-7-16(15)21-17(23)12-29-18(24)11-20-30(27,28)9-8-13-4-2-1-3-5-13/h1-10,20H,11-12H2,(H,21,23)/b9-8+ |
| InChIKey | JPPCXIMRIDFBFT-CMDGGOBGSA-N |
| XLogP | 2.43 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|