C19H18F2N2O6S — CID 3286515
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-phenylethenylsulfonylamino)acetate (PubChem CID 3286515) has the molecular formula C19H18F2N2O6S and a molecular weight of 440.42 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-phenylethenylsulfonylamino)acetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-phenylethenylsulfonylamino)acetate |
|---|---|
| PubChem CID | 3286515 |
| Molecular Formula | C19H18F2N2O6S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-phenylethenylsulfonylamino)acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)C=Cc1ccccc1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H18F2N2O6S/c20-19(21)29-16-9-5-4-8-15(16)23-17(24)13-28-18(25)12-22-30(26,27)11-10-14-6-2-1-3-7-14/h1-11,19,22H,12-13H2,(H,23,24) |
| InChIKey | RYZQQCAYOXTDBA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |