C15H13F2NO4S — CID 112779682
2-(benzenesulfonyl)-N-[2-(difluoromethoxy)phenyl]acetamide (PubChem CID 112779682) has the molecular formula C15H13F2NO4S and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-[2-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-[2-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 112779682 |
| Molecular Formula | C15H13F2NO4S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(benzenesulfonyl)-N-[2-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H13F2NO4S/c16-15(17)22-13-9-5-4-8-12(13)18-14(19)10-23(20,21)11-6-2-1-3-7-11/h1-9,15H,10H2,(H,18,19) |
| InChIKey | AXVPMKYHIWGTSS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |