C16H13F2NO4S — CID 5019415
2-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 5019415) has the molecular formula C16H13F2NO4S and a molecular weight of 353.35 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 5019415 |
| Molecular Formula | C16H13F2NO4S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | O=C(CSc1ccccc1C(=O)O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H13F2NO4S/c17-16(18)23-12-7-3-2-6-11(12)19-14(20)9-24-13-8-4-1-5-10(13)15(21)22/h1-8,16H,9H2,(H,19,20)(H,21,22) |
| InChIKey | DJVDZLVOLLYFER-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |