C15H12F3NO2S — CID 2591520
N-[2-(difluoromethoxy)phenyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 2591520) has the molecular formula C15H12F3NO2S and a molecular weight of 327.33 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 2591520 |
| Molecular Formula | C15H12F3NO2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccccc1F)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H12F3NO2S/c16-10-5-1-4-8-13(10)22-9-14(20)19-11-6-2-3-7-12(11)21-15(17)18/h1-8,15H,9H2,(H,19,20) |
| InChIKey | SLLWCXBZYBVGBI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |