C15H21F2N3O3 — CID 8912661
N-[2-(difluoromethoxy)phenyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide (PubChem CID 8912661) has the molecular formula C15H21F2N3O3 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8912661 |
| Molecular Formula | C15H21F2N3O3 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide |
| SMILES | CC(C)NC(=O)CN(C)CC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H21F2N3O3/c1-10(2)18-13(21)8-20(3)9-14(22)19-11-6-4-5-7-12(11)23-15(16)17/h4-7,10,15H,8-9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | GWSFCNYBXQQXJQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |