C17H19NO3S — CID 2992103
2-(benzenesulfonyl)-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 2992103) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2992103 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1NC(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3S/c1-13(2)15-10-6-7-11-16(15)18-17(19)12-22(20,21)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3,(H,18,19) |
| InChIKey | OWFDUHCXERLLMA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |