C15H15Cl2N3O5S — CID 6513646
[(E)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate (PubChem CID 6513646) has the molecular formula C15H15Cl2N3O5S and a molecular weight of 420.27 g/mol. Its IUPAC name is [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate.
| Compound Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 6513646 |
| Molecular Formula | C15H15Cl2N3O5S |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
| SMILES | C/C(N)=C(/C#N)C(=O)COC(=O)CCNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O5S/c1-9(19)10(7-18)13(21)8-25-14(22)5-6-20-26(23,24)15-11(16)3-2-4-12(15)17/h2-4,20H,5-6,8,19H2,1H3/b10-9+ |
| InChIKey | BZCJHELCTCGMTN-MDZDMXLPSA-N |
| XLogP | 1.53 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|