C26H27N3O10S — CID 23733083
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetate (PubChem CID 23733083) has the molecular formula C26H27N3O10S and a molecular weight of 573.58 g/mol. Its IUPAC name is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetate.
| Compound Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 23733083 |
| Molecular Formula | C26H27N3O10S |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetate |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)c2ccc(OCC(=O)OCC(=O)Nc3cc([N+](=O)[O-])ccc3OC)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O10S/c1-4-37-20-10-12-22(13-11-20)40(34,35)28(2)18-5-8-21(9-6-18)38-17-26(31)39-16-25(30)27-23-15-19(29(32)33)7-14-24(23)36-3/h5-15H,4,16-17H2,1-3H3,(H,27,30) |
| InChIKey | QQXVYDCMDBHUKH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|