C18H17ClN2O4S2 — CID 17247709
1-(benzenesulfonyl)-N-(4-chlorophenyl)-2,5-dimethylpyrrole-3-sulfonamide (PubChem CID 17247709) has the molecular formula C18H17ClN2O4S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(4-chlorophenyl)-2,5-dimethylpyrrole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-N-(4-chlorophenyl)-2,5-dimethylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 17247709 |
| Molecular Formula | C18H17ClN2O4S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(4-chlorophenyl)-2,5-dimethylpyrrole-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)c(C)n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17ClN2O4S2/c1-13-12-18(26(22,23)20-16-10-8-15(19)9-11-16)14(2)21(13)27(24,25)17-6-4-3-5-7-17/h3-12,20H,1-2H3 |
| InChIKey | WFHPLAWGFDKBJS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |