C23H19N3O2S2 — CID 17248461
4-oxo-N-(2-phenylsulfanylphenyl)-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide (PubChem CID 17248461) has the molecular formula C23H19N3O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-oxo-N-(2-phenylsulfanylphenyl)-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide.
| Compound Name | 4-oxo-N-(2-phenylsulfanylphenyl)-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 17248461 |
| Molecular Formula | C23H19N3O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 4-oxo-N-(2-phenylsulfanylphenyl)-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)c1cnc2sc3c(n2c1=O)CCCC3 |
| InChI | InChI=1S/C23H19N3O2S2/c27-21(25-17-10-4-6-12-19(17)29-15-8-2-1-3-9-15)16-14-24-23-26(22(16)28)18-11-5-7-13-20(18)30-23/h1-4,6,8-10,12,14H,5,7,11,13H2,(H,25,27) |
| InChIKey | AXTSEWJCVMNTSM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |