C24H29N3O5S — CID 22575211
4-oxo-N-[(3,4,5-triethoxyphenyl)methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide (PubChem CID 22575211) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-oxo-N-[(3,4,5-triethoxyphenyl)methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide.
| Compound Name | 4-oxo-N-[(3,4,5-triethoxyphenyl)methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 22575211 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-oxo-N-[(3,4,5-triethoxyphenyl)methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
| SMILES | CCOc1cc(CNC(=O)c2cnc3sc4c(n3c2=O)CCCC4)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H29N3O5S/c1-4-30-18-11-15(12-19(31-5-2)21(18)32-6-3)13-25-22(28)16-14-26-24-27(23(16)29)17-9-7-8-10-20(17)33-24/h11-12,14H,4-10,13H2,1-3H3,(H,25,28) |
| InChIKey | QBDLXKYGWLWORR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |