C20H21N3O3S — CID 92650508
N-[(1R)-1-(2-methoxyphenyl)ethyl]-4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide (PubChem CID 92650508) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[(1R)-1-(2-methoxyphenyl)ethyl]-4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide.
| Compound Name | N-[(1R)-1-(2-methoxyphenyl)ethyl]-4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 92650508 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[(1R)-1-(2-methoxyphenyl)ethyl]-4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
| SMILES | COc1ccccc1[C@@H](C)NC(=O)c1cnc2sc3c(n2c1=O)CCCC3 |
| InChI | InChI=1S/C20H21N3O3S/c1-12(13-7-3-5-9-16(13)26-2)22-18(24)14-11-21-20-23(19(14)25)15-8-4-6-10-17(15)27-20/h3,5,7,9,11-12H,4,6,8,10H2,1-2H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | YTENUBKBXNCJGO-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |