C11H19NO4S2 — CID 172500690
1-(thian-4-ylsulfonyl)piperidine-3-carboxylic acid (PubChem CID 172500690) has the molecular formula C11H19NO4S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(thian-4-ylsulfonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(thian-4-ylsulfonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 172500690 |
| Molecular Formula | C11H19NO4S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-(thian-4-ylsulfonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)C2CCSCC2)C1 |
| InChI | InChI=1S/C11H19NO4S2/c13-11(14)9-2-1-5-12(8-9)18(15,16)10-3-6-17-7-4-10/h9-10H,1-8H2,(H,13,14) |
| InChIKey | FMYOLUNIMJSHGH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |