C11H20N2O4S2 — CID 61419208
1-(1,4-thiazepan-4-ylsulfonyl)piperidine-3-carboxylic acid (PubChem CID 61419208) has the molecular formula C11H20N2O4S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(1,4-thiazepan-4-ylsulfonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(1,4-thiazepan-4-ylsulfonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 61419208 |
| Molecular Formula | C11H20N2O4S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(1,4-thiazepan-4-ylsulfonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)N2CCCSCC2)C1 |
| InChI | InChI=1S/C11H20N2O4S2/c14-11(15)10-3-1-4-13(9-10)19(16,17)12-5-2-7-18-8-6-12/h10H,1-9H2,(H,14,15) |
| InChIKey | ZOIDVHPGZKRQMK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |