C14H14ClFN4O4S — CID 172503424
methyl 3-[chloromethyl-(2-fluoro-4-methylsulfonylanilino)amino]pyrazine-2-carboxylate (PubChem CID 172503424) has the molecular formula C14H14ClFN4O4S and a molecular weight of 388.81 g/mol. Its IUPAC name is methyl 3-[chloromethyl-(2-fluoro-4-methylsulfonylanilino)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 3-[chloromethyl-(2-fluoro-4-methylsulfonylanilino)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 172503424 |
| Molecular Formula | C14H14ClFN4O4S |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | methyl 3-[chloromethyl-(2-fluoro-4-methylsulfonylanilino)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccnc1N(CCl)Nc1ccc(S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C14H14ClFN4O4S/c1-24-14(21)12-13(18-6-5-17-12)20(8-15)19-11-4-3-9(7-10(11)16)25(2,22)23/h3-7,19H,8H2,1-2H3 |
| InChIKey | SKVQVYGBMYGVNZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|