C17H9F6NO3 — CID 172506108
(2,3,4,5,6-pentafluorophenyl) 2-(4-fluoro-5-methoxy-1H-indol-3-yl)acetate (PubChem CID 172506108) has the molecular formula C17H9F6NO3 and a molecular weight of 389.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(4-fluoro-5-methoxy-1H-indol-3-yl)acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(4-fluoro-5-methoxy-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 172506108 |
| Molecular Formula | C17H9F6NO3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(4-fluoro-5-methoxy-1H-indol-3-yl)acetate |
| SMILES | COc1ccc2[nH]cc(CC(=O)Oc3c(F)c(F)c(F)c(F)c3F)c2c1F |
| InChI | InChI=1S/C17H9F6NO3/c1-26-8-3-2-7-10(11(8)18)6(5-24-7)4-9(25)27-17-15(22)13(20)12(19)14(21)16(17)23/h2-3,5,24H,4H2,1H3 |
| InChIKey | IHIYHHFATHAXCZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|