C16H17NO2 — CID 172506149
(1R,15S,17S)-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-7-ol (PubChem CID 172506149) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (1R,15S,17S)-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-7-ol.
| Compound Name | (1R,15S,17S)-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-7-ol |
|---|---|
| PubChem CID | 172506149 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (1R,15S,17S)-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-7-ol |
| SMILES | Oc1ccc2oc3c(c2c1)CCN1C[C@H]2C[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C16H17NO2/c18-10-1-2-15-12(7-10)11-3-4-17-8-9-5-13(14(17)6-9)16(11)19-15/h1-2,7,9,13-14,18H,3-6,8H2/t9-,13+,14-/m0/s1 |
| InChIKey | BSGHGTZRZDQVOV-FZZIBODNSA-N |
| XLogP | 2.87 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |