C19H23NO — CID 122225312
(1R,15R,17S,18S)-17-ethyl-3-oxa-13-azapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene (PubChem CID 122225312) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (1R,15R,17S,18S)-17-ethyl-3-oxa-13-azapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene.
| Compound Name | (1R,15R,17S,18S)-17-ethyl-3-oxa-13-azapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 122225312 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (1R,15R,17S,18S)-17-ethyl-3-oxa-13-azapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene |
| SMILES | CC[C@H]1C[C@@H]2C[C@H]3c4oc5ccccc5c4CCN(C2)[C@@H]13 |
| InChI | InChI=1S/C19H23NO/c1-2-13-9-12-10-16-18(13)20(11-12)8-7-15-14-5-3-4-6-17(14)21-19(15)16/h3-6,12-13,16,18H,2,7-11H2,1H3/t12-,13+,16-,18+/m1/s1 |
| InChIKey | FVSRZNOUTAWCOD-RGFKIIKPSA-N |
| XLogP | 4.19 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |