C24H19F4N5O — CID 172507081
(4-amino-7-fluoroimidazo[1,5-a]quinoxalin-8-yl)-[(4aR)-7-(trifluoromethyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-1-yl]methanone (PubChem CID 172507081) has the molecular formula C24H19F4N5O and a molecular weight of 469.44 g/mol. Its IUPAC name is (4-amino-7-fluoroimidazo[1,5-a]quinoxalin-8-yl)-[(4aR)-7-(trifluoromethyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-1-yl]methanone.
| Compound Name | (4-amino-7-fluoroimidazo[1,5-a]quinoxalin-8-yl)-[(4aR)-7-(trifluoromethyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 172507081 |
| Molecular Formula | C24H19F4N5O |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (4-amino-7-fluoroimidazo[1,5-a]quinoxalin-8-yl)-[(4aR)-7-(trifluoromethyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-1-yl]methanone |
| SMILES | Nc1nc2cc(F)c(C(=O)N3CCC[C@@H]4Cc5cc(C(F)(F)F)ccc5C43)cc2n2cncc12 |
| InChI | InChI=1S/C24H19F4N5O/c25-17-9-18-19(33-11-30-10-20(33)22(29)31-18)8-16(17)23(34)32-5-1-2-12-6-13-7-14(24(26,27)28)3-4-15(13)21(12)32/h3-4,7-12,21H,1-2,5-6H2,(H2,29,31)/t12-,21?/m1/s1 |
| InChIKey | XLQLDYMWNJXTRL-FXADVQPWSA-N |
| XLogP | 4.77 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |