C33H30F3N5O2 — CID 172508197
5-ethynyl-6-fluoro-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[methyl(spiro[2.2]pentan-2-yl)amino]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 172508197) has the molecular formula C33H30F3N5O2 and a molecular weight of 585.63 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[methyl(spiro[2.2]pentan-2-yl)amino]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[methyl(spiro[2.2]pentan-2-yl)amino]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 172508197 |
| Molecular Formula | C33H30F3N5O2 |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[methyl(spiro[2.2]pentan-2-yl)amino]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N(C)C5CC56CC6)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C33H30F3N5O2/c1-3-21-24(35)6-5-18-11-20(42)12-22(26(18)21)28-27(36)29-23(15-37-28)30(40(2)25-14-32(25)8-9-32)39-31(38-29)43-17-33-7-4-10-41(33)16-19(34)13-33/h1,5-6,11-12,15,19,25,42H,4,7-10,13-14,16-17H2,2H3/t19-,25?,33+/m1/s1 |
| InChIKey | PGDIAOBZRREYGE-XFBOSMCGSA-N |
| XLogP | 5.75 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|