C32H38Cl2N6O2 — CID 172511364
4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]-2-(4-piperidin-4-ylpiperazin-1-yl)pyrimidine (PubChem CID 172511364) has the molecular formula C32H38Cl2N6O2 and a molecular weight of 609.60 g/mol. Its IUPAC name is 4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]-2-(4-piperidin-4-ylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]-2-(4-piperidin-4-ylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 172511364 |
| Molecular Formula | C32H38Cl2N6O2 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]-2-(4-piperidin-4-ylpiperazin-1-yl)pyrimidine |
| SMILES | [C-]#[N+]c1cc(C(C)(C)c2ccc(OCc3ccnc(N4CCN(C5CCNCC5)CC4)n3)cc2)cc(Cl)c1OCCCl |
| InChI | InChI=1S/C32H38Cl2N6O2/c1-32(2,24-20-28(34)30(41-19-11-33)29(21-24)35-3)23-4-6-27(7-5-23)42-22-25-8-14-37-31(38-25)40-17-15-39(16-18-40)26-9-12-36-13-10-26/h4-8,14,20-21,26,36H,9-13,15-19,22H2,1-2H3 |
| InChIKey | OANKVQUVRWGDPS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|