C32H37Cl2N5O4 — CID 172511671
tert-butyl 4-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 172511671) has the molecular formula C32H37Cl2N5O4 and a molecular weight of 626.59 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172511671 |
| Molecular Formula | C32H37Cl2N5O4 |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | tert-butyl 4-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-isocyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1cc(C(C)(C)c2ccc(OCc3ccnc(N4CCN(C(=O)OC(C)(C)C)CC4)n3)cc2)cc(Cl)c1OCCCl |
| InChI | InChI=1S/C32H37Cl2N5O4/c1-31(2,3)43-30(40)39-16-14-38(15-17-39)29-36-13-11-24(37-29)21-42-25-9-7-22(8-10-25)32(4,5)23-19-26(34)28(41-18-12-33)27(20-23)35-6/h7-11,13,19-20H,12,14-18,21H2,1-5H3 |
| InChIKey | JRICAGTXPGZCHH-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|