C42H26N2S — CID 172512112
1,2,3,4,5,7,8-heptadeuterio-6-(1,2,4,5,6,7,8-heptadeuterio-9-dibenzothiophen-3-ylcarbazol-3-yl)-9-(2,4,6-trideuteriophenyl)carbazole (PubChem CID 172512112) has the molecular formula C42H26N2S and a molecular weight of 607.85 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-6-(1,2,4,5,6,7,8-heptadeuterio-9-dibenzothiophen-3-ylcarbazol-3-yl)-9-(2,4,6-trideuteriophenyl)carbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-6-(1,2,4,5,6,7,8-heptadeuterio-9-dibenzothiophen-3-ylcarbazol-3-yl)-9-(2,4,6-trideuteriophenyl)carbazole |
|---|---|
| PubChem CID | 172512112 |
| Molecular Formula | C42H26N2S |
| Molecular Weight | 607.85 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-6-(1,2,4,5,6,7,8-heptadeuterio-9-dibenzothiophen-3-ylcarbazol-3-yl)-9-(2,4,6-trideuteriophenyl)carbazole |
| SMILES | [2H]c1cc([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c(-c4c([2H])c([2H])c5c(c4[2H])c4c([2H])c([2H])c([2H])c([2H])c4n5-c4ccc5c(c4)sc4ccccc45)c([2H])c([2H])c32)c([2H])c1 |
| InChI | InChI=1S/C42H26N2S/c1-2-10-29(11-3-1)43-37-15-7-4-12-31(37)35-24-27(18-22-39(35)43)28-19-23-40-36(25-28)32-13-5-8-16-38(32)44(40)30-20-21-34-33-14-6-9-17-41(33)45-42(34)26-30/h1-26H/i1D,4D,5D,7D,8D,10D,11D,12D,13D,15D,16D,18D,19D,22D,23D,24D,25D |
| InChIKey | GPJVLIDMHKQKKE-BITDEGIVSA-N |
| XLogP | 11.92 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.85 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |