C46H29N3S — CID 176767051
1,2,3,4,5,7,8-heptadeuterio-6-[6-dibenzothiophen-4-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 176767051) has the molecular formula C46H29N3S and a molecular weight of 667.90 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-6-[6-dibenzothiophen-4-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-6-[6-dibenzothiophen-4-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 176767051 |
| Molecular Formula | C46H29N3S |
| Molecular Weight | 667.90 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-6-[6-dibenzothiophen-4-yl-2-(4-phenylphenyl)pyrimidin-4-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c(-c4cc(-c5cccc6c5sc5ccccc56)nc(-c5ccc(-c6ccccc6)cc5)n4)c([2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C46H29N3S/c1-3-12-30(13-4-1)31-22-24-32(25-23-31)46-47-40(29-41(48-46)38-19-11-18-37-36-17-8-10-21-44(36)50-45(37)38)33-26-27-43-39(28-33)35-16-7-9-20-42(35)49(43)34-14-5-2-6-15-34/h1-29H/i2D,5D,6D,7D,9D,14D,15D,16D,20D,26D,27D,28D |
| InChIKey | SWKJMBZZOUZMSO-BODYKUSBSA-N |
| XLogP | 12.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.90 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |