C19H14O — CID 172513333
4,6-dideuterio-3-methyl-1-phenyldibenzofuran (PubChem CID 172513333) has the molecular formula C19H14O and a molecular weight of 260.33 g/mol. Its IUPAC name is 4,6-dideuterio-3-methyl-1-phenyldibenzofuran.
| Compound Name | 4,6-dideuterio-3-methyl-1-phenyldibenzofuran |
|---|---|
| PubChem CID | 172513333 |
| Molecular Formula | C19H14O |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4,6-dideuterio-3-methyl-1-phenyldibenzofuran |
| SMILES | [2H]c1cccc2c1oc1c([2H])c(C)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C19H14O/c1-13-11-16(14-7-3-2-4-8-14)19-15-9-5-6-10-17(15)20-18(19)12-13/h2-12H,1H3/i10D,12D |
| InChIKey | JFMVTKAGVAOEKC-SQSURYJASA-N |
| XLogP | 5.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |