C41H25N3O — CID 170926834
2-phenanthren-3-yl-4-(2-phenylphenyl)-6-(2,6,8-trideuteriodibenzofuran-1-yl)-1,3,5-triazine (PubChem CID 170926834) has the molecular formula C41H25N3O and a molecular weight of 578.69 g/mol. Its IUPAC name is 2-phenanthren-3-yl-4-(2-phenylphenyl)-6-(2,6,8-trideuteriodibenzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-phenanthren-3-yl-4-(2-phenylphenyl)-6-(2,6,8-trideuteriodibenzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170926834 |
| Molecular Formula | C41H25N3O |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 2-phenanthren-3-yl-4-(2-phenylphenyl)-6-(2,6,8-trideuteriodibenzofuran-1-yl)-1,3,5-triazine |
| SMILES | [2H]c1cc([2H])c2oc3ccc([2H])c(-c4nc(-c5ccc6ccc7ccccc7c6c5)nc(-c5ccccc5-c5ccccc5)n4)c3c2c1 |
| InChI | InChI=1S/C41H25N3O/c1-2-11-26(12-3-1)30-14-6-7-16-32(30)40-42-39(29-24-23-28-22-21-27-13-4-5-15-31(27)35(28)25-29)43-41(44-40)34-18-10-20-37-38(34)33-17-8-9-19-36(33)45-37/h1-25H/i8D,18D,19D |
| InChIKey | GYFQXALUWFHFOR-XEARXXSYSA-N |
| XLogP | 10.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|