C17H36O7 — CID 172513844
2-[1-butoxy-3-(1-butoxy-3-hydroxypropan-2-yl)oxypropan-2-yl]oxypropane-1,3-diol (PubChem CID 172513844) has the molecular formula C17H36O7 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[1-butoxy-3-(1-butoxy-3-hydroxypropan-2-yl)oxypropan-2-yl]oxypropane-1,3-diol.
| Compound Name | 2-[1-butoxy-3-(1-butoxy-3-hydroxypropan-2-yl)oxypropan-2-yl]oxypropane-1,3-diol |
|---|---|
| PubChem CID | 172513844 |
| Molecular Formula | C17H36O7 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-[1-butoxy-3-(1-butoxy-3-hydroxypropan-2-yl)oxypropan-2-yl]oxypropane-1,3-diol |
| SMILES | CCCCOCC(CO)OCC(COCCCC)OC(CO)CO |
| InChI | InChI=1S/C17H36O7/c1-3-5-7-21-12-16(11-20)23-14-17(13-22-8-6-4-2)24-15(9-18)10-19/h15-20H,3-14H2,1-2H3 |
| InChIKey | YVPOJWNXFUVMFV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|