C22H40N2O3 — CID 172516328
1-[3-[[dimethyl(oxido)azaniumyl]methyl]-5-ethyl-2-octoxyphenyl]-N,N-dimethylmethanamine oxide (PubChem CID 172516328) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is 1-[3-[[dimethyl(oxido)azaniumyl]methyl]-5-ethyl-2-octoxyphenyl]-N,N-dimethylmethanamine oxide.
| Compound Name | 1-[3-[[dimethyl(oxido)azaniumyl]methyl]-5-ethyl-2-octoxyphenyl]-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 172516328 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | 1-[3-[[dimethyl(oxido)azaniumyl]methyl]-5-ethyl-2-octoxyphenyl]-N,N-dimethylmethanamine oxide |
| SMILES | CCCCCCCCOc1c(C[N+](C)(C)[O-])cc(CC)cc1C[N+](C)(C)[O-] |
| InChI | InChI=1S/C22H40N2O3/c1-7-9-10-11-12-13-14-27-22-20(17-23(3,4)25)15-19(8-2)16-21(22)18-24(5,6)26/h15-16H,7-14,17-18H2,1-6H3 |
| InChIKey | HHLSXRPTGBONNJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|