C40H68N2O6 — CID 172516334
N,N'-bis[(5-ethyl-3-methoxy-2-octoxyphenyl)methyl]-N,N'-dimethylethane-1,2-diamine oxide (PubChem CID 172516334) has the molecular formula C40H68N2O6 and a molecular weight of 672.99 g/mol. Its IUPAC name is N,N'-bis[(5-ethyl-3-methoxy-2-octoxyphenyl)methyl]-N,N'-dimethylethane-1,2-diamine oxide.
| Compound Name | N,N'-bis[(5-ethyl-3-methoxy-2-octoxyphenyl)methyl]-N,N'-dimethylethane-1,2-diamine oxide |
|---|---|
| PubChem CID | 172516334 |
| Molecular Formula | C40H68N2O6 |
| Molecular Weight | 672.99 g/mol |
| Exact Mass | 672.51 |
| IUPAC Name | N,N'-bis[(5-ethyl-3-methoxy-2-octoxyphenyl)methyl]-N,N'-dimethylethane-1,2-diamine oxide |
| SMILES | CCCCCCCCOc1c(C[N+](C)([O-])CC[N+](C)([O-])Cc2cc(CC)cc(OC)c2OCCCCCCCC)cc(CC)cc1OC |
| InChI | InChI=1S/C40H68N2O6/c1-9-13-15-17-19-21-25-47-39-35(27-33(11-3)29-37(39)45-7)31-41(5,43)23-24-42(6,44)32-36-28-34(12-4)30-38(46-8)40(36)48-26-22-20-18-16-14-10-2/h27-30H,9-26,31-32H2,1-8H3 |
| InChIKey | PTWWXJABXHKEAQ-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.99 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|