C45H28N4O — CID 172516363
1,2,3,4,5,6,8-heptadeuterio-9-[2,4-dideuterio-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]carbazole (PubChem CID 172516363) has the molecular formula C45H28N4O and a molecular weight of 649.80 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2,4-dideuterio-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2,4-dideuterio-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 172516363 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2,4-dideuterio-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c(-n2c3c([2H])cc([2H])c([2H])c3c3c([2H])c([2H])c([2H])c([2H])c32)cc1-c1ccc2oc3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2c1 |
| InChI | InChI=1S/C45H28N4O/c1-3-13-29(14-4-1)43-46-44(30-15-5-2-6-16-30)48-45(47-43)36-21-12-24-41-42(36)37-28-32(25-26-40(37)50-41)31-17-11-18-33(27-31)49-38-22-9-7-19-34(38)35-20-8-10-23-39(35)49/h1-28H/i7D,8D,9D,17D,18D,19D,20D,22D,23D |
| InChIKey | PKINQHLCEWUQCB-XDVVKTDWSA-N |
| XLogP | 11.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |