C51H32N4O — CID 170536757
1,3,4,5,6,8-hexadeuterio-9-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-5-phenylphenyl]carbazole (PubChem CID 170536757) has the molecular formula C51H32N4O and a molecular weight of 722.88 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-5-phenylphenyl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-5-phenylphenyl]carbazole |
|---|---|
| PubChem CID | 170536757 |
| Molecular Formula | C51H32N4O |
| Molecular Weight | 722.88 g/mol |
| Exact Mass | 722.30 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-5-phenylphenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1cc(-c2ccccc2)cc(-c2cccc3c2oc2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c23)c1 |
| InChI | InChI=1S/C51H32N4O/c1-4-16-33(17-5-1)36-30-37(32-38(31-36)55-44-27-12-10-22-40(44)41-23-11-13-28-45(41)55)39-24-14-25-42-47-43(26-15-29-46(47)56-48(39)42)51-53-49(34-18-6-2-7-19-34)52-50(54-51)35-20-8-3-9-21-35/h1-32H/i10D,11D,22D,23D,27D,28D |
| InChIKey | YMIJRCQXWWBMFO-UAMKQDGISA-N |
| XLogP | 13.20 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.88 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |