C20H21Cl2FN4O3 — CID 172516584
tert-butyl 3-(2,7-dichloro-8-fluoro-5-methoxyquinazolin-4-yl)-3,8-diazabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 172516584) has the molecular formula C20H21Cl2FN4O3 and a molecular weight of 455.32 g/mol. Its IUPAC name is tert-butyl 3-(2,7-dichloro-8-fluoro-5-methoxyquinazolin-4-yl)-3,8-diazabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | tert-butyl 3-(2,7-dichloro-8-fluoro-5-methoxyquinazolin-4-yl)-3,8-diazabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 172516584 |
| Molecular Formula | C20H21Cl2FN4O3 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | tert-butyl 3-(2,7-dichloro-8-fluoro-5-methoxyquinazolin-4-yl)-3,8-diazabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | COc1cc(Cl)c(F)c2nc(Cl)nc(N3CC4C=CC(C3)N4C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C20H21Cl2FN4O3/c1-20(2,3)30-19(28)27-10-5-6-11(27)9-26(8-10)17-14-13(29-4)7-12(21)15(23)16(14)24-18(22)25-17/h5-7,10-11H,8-9H2,1-4H3 |
| InChIKey | XKEIVQZOYMJAAL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|