C23H30F3N5O — CID 172516753
6-[4-(4-hexoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 172516753) has the molecular formula C23H30F3N5O and a molecular weight of 449.52 g/mol. Its IUPAC name is 6-[4-(4-hexoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-(4-hexoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 172516753 |
| Molecular Formula | C23H30F3N5O |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 6-[4-(4-hexoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCCCCCOc1ccc(C2CCN(C3=Nn4c(nnc4C(F)(F)F)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H30F3N5O/c1-2-3-4-5-16-32-19-8-6-17(7-9-19)18-12-14-30(15-13-18)21-11-10-20-27-28-22(23(24,25)26)31(20)29-21/h6-9,18H,2-5,10-16H2,1H3 |
| InChIKey | CJESCFVMHRXFEX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|