C26H36F3N7O3S — CID 91157995
6-[4-[4-[3-(4-methylsulfonylazepan-1-yl)propoxy]phenyl]piperazin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 91157995) has the molecular formula C26H36F3N7O3S and a molecular weight of 583.68 g/mol. Its IUPAC name is 6-[4-[4-[3-(4-methylsulfonylazepan-1-yl)propoxy]phenyl]piperazin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-[4-[3-(4-methylsulfonylazepan-1-yl)propoxy]phenyl]piperazin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 91157995 |
| Molecular Formula | C26H36F3N7O3S |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 6-[4-[4-[3-(4-methylsulfonylazepan-1-yl)propoxy]phenyl]piperazin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CS(=O)(=O)C1CCCN(CCCOc2ccc(N3CCN(C4=Nn5c(nnc5C(F)(F)F)CC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H36F3N7O3S/c1-40(37,38)22-4-2-12-33(14-11-22)13-3-19-39-21-7-5-20(6-8-21)34-15-17-35(18-16-34)24-10-9-23-30-31-25(26(27,28)29)36(23)32-24/h5-8,22H,2-4,9-19H2,1H3 |
| InChIKey | NHLUQLJMSDDBPJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|